tert-Butyl 3-hydroxy-4-methylenepiperidine-1-carboxylate structure
|
Common Name | tert-Butyl 3-hydroxy-4-methylenepiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 159635-22-0 | Molecular Weight | 213.273 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 309.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.7±27.9 °C | |
| Name | tert-butyl 3-hydroxy-4-methylidenepiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 309.0±42.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.273 |
| Flash Point | 140.7±27.9 °C |
| Exact Mass | 213.136490 |
| PSA | 49.77000 |
| LogP | 0.93 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | IMRNHROGUGVTAI-UHFFFAOYSA-N |
| SMILES | C=C1CCN(C(=O)OC(C)(C)C)CC1O |
| HS Code | 2933399090 |
|---|
|
~63%
tert-Butyl 3-hy... CAS#:159635-22-0 |
| Literature: Vice; Bara; Bauer; Evans; Ford; Josien; McCombie; Miller; Nazareno; Palani; Tagat Journal of Organic Chemistry, 2001 , vol. 66, # 7 p. 2487 - 2492 |
|
~75%
tert-Butyl 3-hy... CAS#:159635-22-0 |
| Literature: JANSSEN PHARMACEUTICA, N.V. Patent: WO2009/67202 A1, 2009 ; Location in patent: Page/Page column 143 ; WO 2009/067202 A1 |
|
~%
tert-Butyl 3-hy... CAS#:159635-22-0 |
| Literature: WO2013/80222 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 3-hydroxy-4-methylene-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3-hydroxy-4-methylene-1-piperidinecarboxylate |
| 1-t-butoxycarbonyl-3-hydroxy-4-methylenepiperidine |
| W3461 |
| 1-Boc-3-Hydroxy-4-methylenepiperidine |
| 3-hydroxy-4-methylene-1-piperidinecarboxylic acid 1,1-dimethylethyl ester |
| 3-hydroxy-4-methylene-piperidine-1-carboxylic acid tert-butyl ester |
| 1-[(1,1-dimethylethoxy)carbonyl]-3-hydroxy-4-methylene-1,2,5,6-tetrahydropyridine |
| tert-Butyl 3-hydroxy-4-methylenepiperidine-1-carboxylate |
| N-T-BOC-4-METHYLENE-3-PIPERIDINOL |