3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine
Modify Date: 2025-09-09 18:18:24
![3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine Structure](https://www.chemsrc.com/extcaspic/008/1596657-06-5.png)
3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine structure
|
Common Name | 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine | ||
|---|---|---|---|---|
| CAS Number | 1596657-06-5 | Molecular Weight | 227.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18ClN3 |
|---|---|
| Molecular Weight | 227.73 |
| InChIKey | YLZNSEKQQACQHN-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)c(Cl)c1CC1CCCNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1596657-06-5? |
| A: Chinese name of 1596657-06-5 is 1596657-06-5. |
| Q: What is the molecular weight of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine? |
| A: Molecular weight of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine is 227.73. |
| Q: What is the SMILES notation of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine? |
| A: SMILES notation of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine is Cc1nn(C)c(Cl)c1CC1CCCNC1. |
| Q: What is the English name of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine? |
| A: The English name of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine is 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine. |
| Q: What is the InChIKey of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine? |
| A: InChIKey of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine is YLZNSEKQQACQHN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine? |
| A: CAS number of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine is 1596657-06-5. |
| Q: What is the molecular formula of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine? |
| A: Molecular formula of 3-[(5-chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperidine is C11H18ClN3. |