1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene
Modify Date: 2025-09-10 10:28:06
![1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene Structure](https://www.chemsrc.com/extcaspic/449/1596912-18-3.png)
1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene structure
|
Common Name | 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 1596912-18-3 | Molecular Weight | 346.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10ClF2IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10ClF2IO |
|---|---|
| Molecular Weight | 346.54 |
| InChIKey | KZHPVRTWJULZFN-UHFFFAOYSA-N |
| SMILES | FC(F)COC(CI)c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene? |
| A: SMILES notation of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene is FC(F)COC(CI)c1ccc(Cl)cc1. |
| Q: What is the Chinese name of 1596912-18-3? |
| A: Chinese name of 1596912-18-3 is 1596912-18-3. |
| Q: What is the English name of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene? |
| A: The English name of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene is 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene. |
| Q: What is the molecular weight of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene? |
| A: Molecular weight of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene is 346.54. |
| Q: What is the CAS number of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene? |
| A: CAS number of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene is 1596912-18-3. |
| Q: What is the molecular formula of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene? |
| A: Molecular formula of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene is C10H10ClF2IO. |
| Q: What is the InChIKey of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene? |
| A: InChIKey of 1-Chloro-4-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene is KZHPVRTWJULZFN-UHFFFAOYSA-N. |