3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide
Modify Date: 2026-08-08 20:06:44
3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide structure
|
Common Name | 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 1596918-35-2 | Molecular Weight | 344.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17IO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17IO3S |
|---|---|
| Molecular Weight | 344.21 |
| InChIKey | YNCFRKOKSQOTSW-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CC(I)C(OCC2CCCC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide? |
| A: SMILES notation of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide is O=S1(=O)CC(I)C(OCC2CCCC2)C1. |
| Q: What is the molecular formula of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide? |
| A: Molecular formula of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide is C10H17IO3S. |
| Q: What is the CAS number of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide? |
| A: CAS number of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide is 1596918-35-2. |
| Q: What is the InChIKey of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide? |
| A: InChIKey of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide is YNCFRKOKSQOTSW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1596918-35-2? |
| A: Chinese name of 1596918-35-2 is 1596918-35-2. |
| Q: What is the molecular weight of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide? |
| A: Molecular weight of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide is 344.21. |
| Q: What is the English name of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide? |
| A: The English name of 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide is 3-(Cyclopentylmethoxy)-4-iodotetrahydrothiophene 1,1-dioxide. |