2-Bromo-4-methyl-5-nitrobenzaldehyde structure
|
Common Name | 2-Bromo-4-methyl-5-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 159730-72-0 | Molecular Weight | 244.042 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 318.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H6BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.6±27.9 °C | |
| Name | 2-Bromo-4-methyl-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.8±42.0 °C at 760 mmHg |
| Molecular Formula | C8H6BrNO3 |
| Molecular Weight | 244.042 |
| Flash Point | 146.6±27.9 °C |
| Exact Mass | 242.953094 |
| PSA | 62.89000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | OKHCEMLRYRLMEX-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c(C=O)cc1[N+](=O)[O-] |
| HS Code | 2913000090 |
|---|
|
~70%
2-Bromo-4-methy... CAS#:159730-72-0 |
| Literature: Bayer Cropscience AG Patent: US8299301 B2, 2012 ; Location in patent: Page/Page column 49 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2-Bromo-4-methyl-5-nitrobenzaldehyde |
| Benzaldehyde,2-bromo-4-methyl-5-nitro |
| Benzaldehyde, 2-bromo-4-methyl-5-nitro- |