1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene
Modify Date: 2025-09-10 12:16:08
![1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene Structure](https://www.chemsrc.com/extcaspic/043/1597318-60-9.png)
1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene structure
|
Common Name | 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene | ||
|---|---|---|---|---|
| CAS Number | 1597318-60-9 | Molecular Weight | 393.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12Cl3IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12Cl3IO |
|---|---|
| Molecular Weight | 393.5 |
| InChIKey | CQWZUKYRRXTLOG-UHFFFAOYSA-N |
| SMILES | ClCC(I)C(CCl)OCc1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene? |
| A: SMILES notation of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene is ClCC(I)C(CCl)OCc1ccc(Cl)cc1. |
| Q: What is the CAS number of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene? |
| A: CAS number of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene is 1597318-60-9. |
| Q: What is the molecular weight of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene? |
| A: Molecular weight of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene is 393.5. |
| Q: What is the InChIKey of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene? |
| A: InChIKey of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene is CQWZUKYRRXTLOG-UHFFFAOYSA-N. |
| Q: What is the English name of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene? |
| A: The English name of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene is 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene. |
| Q: What is the Chinese name of 1597318-60-9? |
| A: Chinese name of 1597318-60-9 is 1597318-60-9. |
| Q: What is the molecular formula of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene? |
| A: Molecular formula of 1-Chloro-4-{[(1,4-dichloro-3-iodobutan-2-yl)oxy]methyl}benzene is C11H12Cl3IO. |