4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane
Modify Date: 2025-09-09 18:26:49
![4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane Structure](https://www.chemsrc.com/extcaspic/340/1597360-09-2.png)
4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane structure
|
Common Name | 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane | ||
|---|---|---|---|---|
| CAS Number | 1597360-09-2 | Molecular Weight | 336.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25IO |
|---|---|
| Molecular Weight | 336.25 |
| InChIKey | JOJZKJLJJIZWLM-UHFFFAOYSA-N |
| SMILES | CC1CCC(OC2(CI)CCCC2)CC1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane? |
| A: The English name of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane is 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane. |
| Q: What is the CAS number of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane? |
| A: CAS number of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane is 1597360-09-2. |
| Q: What is the SMILES notation of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane? |
| A: SMILES notation of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane is CC1CCC(OC2(CI)CCCC2)CC1C. |
| Q: What is the InChIKey of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane? |
| A: InChIKey of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane is JOJZKJLJJIZWLM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane? |
| A: Molecular formula of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane is C14H25IO. |
| Q: What is the Chinese name of 1597360-09-2? |
| A: Chinese name of 1597360-09-2 is 1597360-09-2. |
| Q: What is the molecular weight of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane? |
| A: Molecular weight of 4-{[1-(Iodomethyl)cyclopentyl]oxy}-1,2-dimethylcyclohexane is 336.25. |