4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl)
Modify Date: 2026-08-06 10:33:26
4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) structure
|
Common Name | 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) | ||
|---|---|---|---|---|
| CAS Number | 1597858-29-1 | Molecular Weight | 203.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13NO2 |
|---|---|
| Molecular Weight | 203.24 |
| InChIKey | ZRVCEGBRJKGKGD-UHFFFAOYSA-N |
| SMILES | C#CCC(N)C(=O)c1cccc(OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl)? |
| A: SMILES notation of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) is C#CCC(N)C(=O)c1cccc(OC)c1. |
| Q: What is the molecular weight of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl)? |
| A: Molecular weight of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) is 203.24. |
| Q: What is the InChIKey of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl)? |
| A: InChIKey of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) is ZRVCEGBRJKGKGD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl)? |
| A: Molecular formula of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) is C12H13NO2. |
| Q: What is the CAS number of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl)? |
| A: CAS number of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) is 1597858-29-1. |
| Q: What is the Chinese name of 1597858-29-1? |
| A: Chinese name of 1597858-29-1 is 1597858-29-1. |
| Q: What is the English name of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl)? |
| A: The English name of 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl) is 4-Pentyn-1-one, 2-amino-1-(3-methoxyphenyl). |