{1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene
Modify Date: 2026-08-08 18:04:04
![{1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene Structure](https://www.chemsrc.com/extcaspic/375/1597960-55-8.png)
{1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene structure
|
Common Name | {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene | ||
|---|---|---|---|---|
| CAS Number | 1597960-55-8 | Molecular Weight | 334.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19IO2 |
|---|---|
| Molecular Weight | 334.19 |
| InChIKey | NVQNUNMHBLNTJT-UHFFFAOYSA-N |
| SMILES | COCC(C)OC(C)(CI)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene? |
| A: Molecular weight of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene is 334.19. |
| Q: What is the English name of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene? |
| A: The English name of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene is {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene. |
| Q: What is the molecular formula of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene? |
| A: Molecular formula of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene is C13H19IO2. |
| Q: What is the Chinese name of 1597960-55-8? |
| A: Chinese name of 1597960-55-8 is 1597960-55-8. |
| Q: What is the SMILES notation of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene? |
| A: SMILES notation of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene is COCC(C)OC(C)(CI)c1ccccc1. |
| Q: What is the CAS number of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene? |
| A: CAS number of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene is 1597960-55-8. |
| Q: What is the InChIKey of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene? |
| A: InChIKey of {1-Iodo-2-[(1-methoxypropan-2-yl)oxy]propan-2-yl}benzene is NVQNUNMHBLNTJT-UHFFFAOYSA-N. |