1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene
Modify Date: 2025-09-09 15:18:10
![1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene Structure](https://www.chemsrc.com/extcaspic/006/1599236-90-4.png)
1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene structure
|
Common Name | 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 1599236-90-4 | Molecular Weight | 330.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12BrCl2FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12BrCl2FO |
|---|---|
| Molecular Weight | 330.02 |
| InChIKey | LQMSZEZLVFHDQC-UHFFFAOYSA-N |
| SMILES | Fc1ccccc1COC(CCl)C(Br)CCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene? |
| A: SMILES notation of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene is Fc1ccccc1COC(CCl)C(Br)CCl. |
| Q: What is the InChIKey of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene? |
| A: InChIKey of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene is LQMSZEZLVFHDQC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene? |
| A: CAS number of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene is 1599236-90-4. |
| Q: What is the English name of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene? |
| A: The English name of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene is 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene. |
| Q: What is the molecular weight of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene? |
| A: Molecular weight of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene is 330.02. |
| Q: What is the molecular formula of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene? |
| A: Molecular formula of 1-{[(3-Bromo-1,4-dichlorobutan-2-yl)oxy]methyl}-2-fluorobenzene is C11H12BrCl2FO. |
| Q: What is the Chinese name of 1599236-90-4? |
| A: Chinese name of 1599236-90-4 is 1599236-90-4. |