Fmoc-Gly-NH-CH2-O-CH2-Cbz structure
|
Common Name | Fmoc-Gly-NH-CH2-O-CH2-Cbz | ||
|---|---|---|---|---|
| CAS Number | 1599440-07-9 | Molecular Weight | 474.51 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 733.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C27H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 397.1±32.9 °C | |
Use of Fmoc-Gly-NH-CH2-O-CH2-CbzFmoc-Gly-NH-CH2-O-CH2-Cbz is a PROTAC linker and a maleimide-GGFG peptide linker. Fmoc-Gly-NH-CH2-O-CH2-Cbz can be used in the synthesis of the Deruxtecan[1]. |
| Name | benzyl 1-(9H-fluoren-9-yl)-3,6-dioxo-2,9-dioxa-4,7-diazaundecan-11-oate |
|---|
| Description | Fmoc-Gly-NH-CH2-O-CH2-Cbz is a PROTAC linker and a maleimide-GGFG peptide linker. Fmoc-Gly-NH-CH2-O-CH2-Cbz can be used in the synthesis of the Deruxtecan[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 733.0±60.0 °C at 760 mmHg |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 |
| Flash Point | 397.1±32.9 °C |
| Exact Mass | 474.505 |
| LogP | 4.97 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | MZOSSDIBSRKPCO-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)OCC1c2ccccc2-c2ccccc21)NCOCC(=O)OCc1ccccc1 |