1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene
Modify Date: 2025-09-10 08:50:24
![1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene Structure](https://www.chemsrc.com/extcaspic/390/1600279-50-2.png)
1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene structure
|
Common Name | 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene | ||
|---|---|---|---|---|
| CAS Number | 1600279-50-2 | Molecular Weight | 354.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16ClIO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16ClIO2 |
|---|---|
| Molecular Weight | 354.61 |
| InChIKey | OLHIMNMHFYPRLH-UHFFFAOYSA-N |
| SMILES | COCC(C)OC(CI)c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1600279-50-2? |
| A: Chinese name of 1600279-50-2 is 1600279-50-2. |
| Q: What is the molecular weight of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: Molecular weight of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is 354.61. |
| Q: What is the molecular formula of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: Molecular formula of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is C12H16ClIO2. |
| Q: What is the InChIKey of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: InChIKey of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is OLHIMNMHFYPRLH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: SMILES notation of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is COCC(C)OC(CI)c1ccc(Cl)cc1. |
| Q: What is the English name of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: The English name of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene. |
| Q: What is the CAS number of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene? |
| A: CAS number of 1-Chloro-4-{2-iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}benzene is 1600279-50-2. |