Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate
Modify Date: 2026-09-22 13:17:36
![Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate Structure](https://www.chemsrc.com/extcaspic/230/1600379-72-3.png)
Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate structure
|
Common Name | Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 1600379-72-3 | Molecular Weight | 211.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17NO3 |
|---|---|
| Molecular Weight | 211.26 |
| InChIKey | HMCJEPNOSQUCEM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC1NCC2CCCC21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate? |
| A: Molecular formula of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate is C11H17NO3. |
| Q: What is the English name of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate? |
| A: The English name of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate is Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate. |
| Q: What is the SMILES notation of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate? |
| A: SMILES notation of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate is COC(=O)C(=O)CC1NCC2CCCC21. |
| Q: What is the Chinese name of 1600379-72-3? |
| A: Chinese name of 1600379-72-3 is 1600379-72-3. |
| Q: What is the molecular weight of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate? |
| A: Molecular weight of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate is 211.26. |
| Q: What is the CAS number of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate? |
| A: CAS number of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate is 1600379-72-3. |
| Q: What is the InChIKey of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate? |
| A: InChIKey of Methyl 3-{octahydrocyclopenta[c]pyrrol-1-yl}-2-oxopropanoate is HMCJEPNOSQUCEM-UHFFFAOYSA-N. |