1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene
Modify Date: 2025-09-09 19:39:56
![1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene Structure](https://www.chemsrc.com/extcaspic/462/1600404-20-3.png)
1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene structure
|
Common Name | 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 1600404-20-3 | Molecular Weight | 350.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16ClIO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16ClIO |
|---|---|
| Molecular Weight | 350.62 |
| InChIKey | KYYUATQACROCTN-UHFFFAOYSA-N |
| SMILES | Clc1cccc(COC2(CI)CCCC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1600404-20-3? |
| A: Chinese name of 1600404-20-3 is 1600404-20-3. |
| Q: What is the molecular formula of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene? |
| A: Molecular formula of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene is C13H16ClIO. |
| Q: What is the CAS number of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene? |
| A: CAS number of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene is 1600404-20-3. |
| Q: What is the InChIKey of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene? |
| A: InChIKey of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene is KYYUATQACROCTN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene? |
| A: SMILES notation of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene is Clc1cccc(COC2(CI)CCCC2)c1. |
| Q: What is the molecular weight of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene? |
| A: Molecular weight of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene is 350.62. |
| Q: What is the English name of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene? |
| A: The English name of 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene is 1-Chloro-3-({[1-(iodomethyl)cyclopentyl]oxy}methyl)benzene. |