3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one
Modify Date: 2026-09-29 07:37:04
3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one structure
|
Common Name | 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 1601005-11-1 | Molecular Weight | 169.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H11N5O |
|---|---|
| Molecular Weight | 169.19 |
| InChIKey | KCVWARARGNEICO-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(N2CCNCC2)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1601005-11-1? |
| A: Chinese name of 1601005-11-1 is 1601005-11-1. |
| Q: What is the InChIKey of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one? |
| A: InChIKey of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one is KCVWARARGNEICO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one? |
| A: SMILES notation of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one is O=c1[nH]nc(N2CCNCC2)[nH]1. |
| Q: What is the CAS number of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one? |
| A: CAS number of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one is 1601005-11-1. |
| Q: What is the molecular formula of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one? |
| A: Molecular formula of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one is C6H11N5O. |
| Q: What is the molecular weight of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one? |
| A: Molecular weight of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one is 169.19. |
| Q: What is the English name of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one? |
| A: The English name of 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one is 3-(piperazin-1-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one. |