1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane
Modify Date: 2026-09-28 17:11:34
![1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane Structure](https://www.chemsrc.com/extcaspic/074/1601071-03-7.png)
1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane structure
|
Common Name | 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane | ||
|---|---|---|---|---|
| CAS Number | 1601071-03-7 | Molecular Weight | 364.96 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10Cl2F3IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H10Cl2F3IO |
|---|---|
| Molecular Weight | 364.96 |
| InChIKey | PEAGTWBXRKBSAZ-UHFFFAOYSA-N |
| SMILES | CC(OC(CCl)C(I)CCl)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane? |
| A: The English name of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane is 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane. |
| Q: What is the molecular weight of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane? |
| A: Molecular weight of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane is 364.96. |
| Q: What is the molecular formula of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane? |
| A: Molecular formula of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane is C7H10Cl2F3IO. |
| Q: What is the CAS number of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane? |
| A: CAS number of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane is 1601071-03-7. |
| Q: What is the Chinese name of 1601071-03-7? |
| A: Chinese name of 1601071-03-7 is 1601071-03-7. |
| Q: What is the SMILES notation of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane? |
| A: SMILES notation of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane is CC(OC(CCl)C(I)CCl)C(F)(F)F. |
| Q: What is the InChIKey of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane? |
| A: InChIKey of 1,4-Dichloro-2-iodo-3-[(1,1,1-trifluoropropan-2-yl)oxy]butane is PEAGTWBXRKBSAZ-UHFFFAOYSA-N. |