1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene
Modify Date: 2025-09-09 14:16:31
![1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene Structure](https://www.chemsrc.com/extcaspic/214/1601081-97-3.png)
1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene structure
|
Common Name | 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene | ||
|---|---|---|---|---|
| CAS Number | 1601081-97-3 | Molecular Weight | 397.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18BrIO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18BrIO |
|---|---|
| Molecular Weight | 397.09 |
| InChIKey | FLSLPQVZIOLBOO-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)OC(CI)c1ccc(Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene? |
| A: SMILES notation of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene is CC(C)C(C)OC(CI)c1ccc(Br)cc1. |
| Q: What is the molecular formula of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene? |
| A: Molecular formula of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene is C13H18BrIO. |
| Q: What is the English name of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene? |
| A: The English name of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene is 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene. |
| Q: What is the molecular weight of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene? |
| A: Molecular weight of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene is 397.09. |
| Q: What is the CAS number of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene? |
| A: CAS number of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene is 1601081-97-3. |
| Q: What is the Chinese name of 1601081-97-3? |
| A: Chinese name of 1601081-97-3 is 1601081-97-3. |
| Q: What is the InChIKey of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene? |
| A: InChIKey of 1-Bromo-4-{2-iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}benzene is FLSLPQVZIOLBOO-UHFFFAOYSA-N. |