1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine structure
|
Common Name | 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 1601096-16-5 | Molecular Weight | 224.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H20N4O |
|---|---|
| Molecular Weight | 224.30 |
| InChIKey | ODDMBZCTKLXIPK-UHFFFAOYSA-N |
| SMILES | COc1c(CN2CCNCC2)c(C)nn1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1601096-16-5? |
| A: Chinese name of 1601096-16-5 is 1601096-16-5. |
| Q: What is the InChIKey of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine? |
| A: InChIKey of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine is ODDMBZCTKLXIPK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine? |
| A: Molecular weight of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine is 224.30. |
| Q: What is the CAS number of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine? |
| A: CAS number of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine is 1601096-16-5. |
| Q: What is the molecular formula of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine? |
| A: Molecular formula of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine is C11H20N4O. |
| Q: What is the English name of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine? |
| A: The English name of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine is 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine. |
| Q: What is the SMILES notation of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine? |
| A: SMILES notation of 1-[(5-methoxy-1,3-dimethyl-1H-pyrazol-4-yl)methyl]piperazine is COc1c(CN2CCNCC2)c(C)nn1C. |