Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate
Modify Date: 2025-09-09 18:28:01
Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate structure
|
Common Name | Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1601729-95-6 | Molecular Weight | 224.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9FO4 |
|---|---|
| Molecular Weight | 224.18 |
| InChIKey | UKJSBTKDVHBNPQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1Cc2ccc(F)cc2C(=O)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate? |
| A: CAS number of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate is 1601729-95-6. |
| Q: What is the molecular weight of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate? |
| A: Molecular weight of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate is 224.18. |
| Q: What is the Chinese name of 1601729-95-6? |
| A: Chinese name of 1601729-95-6 is 1601729-95-6. |
| Q: What is the English name of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate? |
| A: The English name of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate is Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate. |
| Q: What is the SMILES notation of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate? |
| A: SMILES notation of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate is COC(=O)C1Cc2ccc(F)cc2C(=O)O1. |
| Q: What is the molecular formula of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate? |
| A: Molecular formula of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate is C11H9FO4. |
| Q: What is the InChIKey of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate? |
| A: InChIKey of Methyl 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylate is UKJSBTKDVHBNPQ-UHFFFAOYSA-N. |