N-(9-azabicyclo[3.3.1]nonan-3-yl)-1-methylindazole-3-carboxamide structure
|
Common Name | N-(9-azabicyclo[3.3.1]nonan-3-yl)-1-methylindazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 160177-67-3 | Molecular Weight | 298.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22N4O | Melting Point | 167-169ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(9-azabicyclo[3.3.1]nonan-3-yl)-1-methylindazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 167-169ºC |
|---|---|
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.38300 |
| Exact Mass | 298.17900 |
| PSA | 58.95000 |
| LogP | 2.69590 |
| Index of Refraction | 1.721 |
| InChIKey | VIGVTDRZHFWDBM-UHFFFAOYSA-N |
| SMILES | Cn1nc(C(=O)NC2CC3CCCC(C2)N3)c2ccccc21 |
| HS Code | 2934999090 |
|---|
|
~98%
N-(9-azabicyclo... CAS#:160177-67-3 |
| Literature: Sakaguchi; Iwasaki; Iwanaga; Saito; Takahara; Kato; Hanaoka Chemical and Pharmaceutical Bulletin, 2001 , vol. 49, # 4 p. 424 - 436 |
|
~%
N-(9-azabicyclo... CAS#:160177-67-3 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 49, # 4 p. 424 - 436 |
|
~%
N-(9-azabicyclo... CAS#:160177-67-3 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 49, # 4 p. 424 - 436 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9'-Desmethyl-Granisetron |
| M-1286 |
| Granisetron Impurity C |