1-(3-Amino-4-pyridyl)-4-(m-chlorophenyl)piperazine structure
|
Common Name | 1-(3-Amino-4-pyridyl)-4-(m-chlorophenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 16019-53-7 | Molecular Weight | 288.77500 | |
| Density | 1.286g/cm3 | Boiling Point | 515.9ºC at 760 mmHg | |
| Molecular Formula | C15H17ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.8ºC | |
| Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]pyridin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 515.9ºC at 760 mmHg |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.77500 |
| Flash Point | 265.8ºC |
| Exact Mass | 288.11400 |
| PSA | 45.39000 |
| LogP | 3.35500 |
| Vapour Pressure | 9.41E-11mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | CFWROSPUGSKJSY-UHFFFAOYSA-N |
| SMILES | Nc1cnccc1N1CCN(c2cccc(Cl)c2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[4-(3-chloro-phenyl)-piperazin-1-yl]-pyridin-3-ylamine |
| Piperazine,1-(3-amino-4-pyridyl)-4-(3-chlorophenyl) |
| 1-(3-Chlorphenyl)-4-(3-aminopyrid-4-yl)-piperazin |
| 1-(3-Amino-4-pyridyl)-4-(m-chlorophenyl)piperazine |
| 4-(m-Chlorophenyl)-1-(3-amino-4-pyridyl)piperazine |