L-Asparagine,N2-(2,4-dinitrophenyl)- structure
|
Common Name | L-Asparagine,N2-(2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1602-40-0 | Molecular Weight | 298.20900 | |
| Density | 1.676g/cm3 | Boiling Point | 686.1ºC at 760mmHg | |
| Molecular Formula | C10H10N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 368.8ºC | |
| Name | n-2-4-dnp-l-asparagine crystalline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.676g/cm3 |
|---|---|
| Boiling Point | 686.1ºC at 760mmHg |
| Molecular Formula | C10H10N4O7 |
| Molecular Weight | 298.20900 |
| Flash Point | 368.8ºC |
| Exact Mass | 298.05500 |
| PSA | 184.06000 |
| LogP | 2.06320 |
| Vapour Pressure | 9.07E-20mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | NILMEQUBTVNETI-ZETCQYMHSA-N |
| SMILES | NC(=O)CC(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~98%
L-Asparagine,N2... CAS#:1602-40-0 |
| Literature: Liu, Zhongfa; Sayre, Lawrence M. Tetrahedron, 2004 , vol. 60, # 7 p. 1601 - 1610 |
|
~%
L-Asparagine,N2... CAS#:1602-40-0 |
| Literature: Liu, Zhongfa; Sayre, Lawrence M. Tetrahedron, 2004 , vol. 60, # 7 p. 1601 - 1610 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N2-(2,4-Dinitro-phenyl)-L-asparagin |
| N-2,4-dinitrophenyl-L-asparagine |
| DNP-L-ASPARAGINE |
| N-(2,4-Dinitro-phenyl)-L-asparaginsaeure-4-amid |
| N2-(2,4-dinitro-phenyl)-L-asparagine |
| N-(2,4-Dinitro-phenyl)-asparagin |
| 2,4-Dinitrophenyl-L-asparagine |