1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene
Modify Date: 2025-09-09 20:15:46
![1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene Structure](https://www.chemsrc.com/extcaspic/468/1602069-83-9.png)
1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene structure
|
Common Name | 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 1602069-83-9 | Molecular Weight | 332.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21IO |
|---|---|
| Molecular Weight | 332.22 |
| InChIKey | ZPJALNUFIVQPLZ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(CI)OC(C)C(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene? |
| A: Molecular formula of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene is C14H21IO. |
| Q: What is the SMILES notation of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene? |
| A: SMILES notation of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene is Cc1cccc(C(CI)OC(C)C(C)C)c1. |
| Q: What is the English name of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene? |
| A: The English name of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene is 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene. |
| Q: What is the Chinese name of 1602069-83-9? |
| A: Chinese name of 1602069-83-9 is 1602069-83-9. |
| Q: What is the InChIKey of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene? |
| A: InChIKey of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene is ZPJALNUFIVQPLZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene? |
| A: CAS number of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene is 1602069-83-9. |
| Q: What is the molecular weight of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene? |
| A: Molecular weight of 1-{2-Iodo-1-[(3-methylbutan-2-yl)oxy]ethyl}-3-methylbenzene is 332.22. |