1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene
Modify Date: 2025-09-10 00:19:06
![1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene Structure](https://www.chemsrc.com/extcaspic/463/1602142-10-8.png)
1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene structure
|
Common Name | 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 1602142-10-8 | Molecular Weight | 277.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14BrClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14BrClO |
|---|---|
| Molecular Weight | 277.58 |
| InChIKey | FFDOXUGCQRADGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(CBr)OCc1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene? |
| A: Molecular weight of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene is 277.58. |
| Q: What is the English name of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene? |
| A: The English name of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene is 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene. |
| Q: What is the InChIKey of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene? |
| A: InChIKey of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene is FFDOXUGCQRADGQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene? |
| A: SMILES notation of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene is CC(C)(CBr)OCc1ccc(Cl)cc1. |
| Q: What is the Chinese name of 1602142-10-8? |
| A: Chinese name of 1602142-10-8 is 1602142-10-8. |
| Q: What is the molecular formula of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene? |
| A: Molecular formula of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene is C11H14BrClO. |
| Q: What is the CAS number of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene? |
| A: CAS number of 1-{[(1-Bromo-2-methylpropan-2-yl)oxy]methyl}-4-chlorobenzene is 1602142-10-8. |