4-Methoxyphenyl 4-O-(2,3,4,6-Tetra-O-acetyl-beta-D-galactopyranosyl)-2,3,6-tri-O-acetyl-beta-D-glucopyranoside structure
|
Common Name | 4-Methoxyphenyl 4-O-(2,3,4,6-Tetra-O-acetyl-beta-D-galactopyranosyl)-2,3,6-tri-O-acetyl-beta-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 160227-12-3 | Molecular Weight | 742.67500 | |
| Density | 1.361g/cm3 | Boiling Point | 738.9ºC at 760 mmHg | |
| Molecular Formula | C33H42O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.362ºC | |
| Name | Gal[2346Ac]β(1-4)Glc[236Ac]-β-MP |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 738.9ºC at 760 mmHg |
| Molecular Formula | C33H42O19 |
| Molecular Weight | 742.67500 |
| Flash Point | 299.362ºC |
| Exact Mass | 742.23200 |
| PSA | 230.25000 |
| LogP | 0.69370 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | CHQFKIZJLSSYAP-JWSQQRBLSA-N |
| SMILES | COc1ccc(OC2OC(COC(C)=O)C(OC3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)C(OC(C)=O)C2OC(C)=O)cc1 |
| Storage condition | <0°C |
|
~90%
4-Methoxyphenyl... CAS#:160227-12-3 |
| Literature: Zhang, Zhiyuan; Magnusson, Goeran Carbohydrate Research, 1996 , vol. 295, p. 41 - 55 |
|
~77%
4-Methoxyphenyl... CAS#:160227-12-3 |
| Literature: Dasgupta, Somnath; Rajput, Vishal Kumar; Roy, Bimalendu; Mukhopadhyay, Balaram Journal of Carbohydrate Chemistry, 2007 , vol. 26, # 2 p. 91 - 106 |
| [(2S,3R,4S,5S,6S)-4,5-diacetyloxy-6-(4-methoxyphenoxy)-3-[(2S,3S,4S,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| Gal[2346Ac]beta(1-4)Glc[236Ac]-beta-MP |
| LacMP per OAc |