1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene
Modify Date: 2025-09-10 11:05:06
![1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene Structure](https://www.chemsrc.com/extcaspic/418/1602601-82-0.png)
1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene structure
|
Common Name | 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 1602601-82-0 | Molecular Weight | 334.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19IO2 |
|---|---|
| Molecular Weight | 334.19 |
| InChIKey | CQMSXVMZOBNBNX-UHFFFAOYSA-N |
| SMILES | COCC(C)OC(CI)c1ccc(C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene? |
| A: The English name of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene is 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene. |
| Q: What is the SMILES notation of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene? |
| A: SMILES notation of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene is COCC(C)OC(CI)c1ccc(C)cc1. |
| Q: What is the molecular weight of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene? |
| A: Molecular weight of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene is 334.19. |
| Q: What is the molecular formula of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene? |
| A: Molecular formula of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene is C13H19IO2. |
| Q: What is the CAS number of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene? |
| A: CAS number of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene is 1602601-82-0. |
| Q: What is the InChIKey of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene? |
| A: InChIKey of 1-{2-Iodo-1-[(1-methoxypropan-2-yl)oxy]ethyl}-4-methylbenzene is CQMSXVMZOBNBNX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1602601-82-0? |
| A: Chinese name of 1602601-82-0 is 1602601-82-0. |