2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid
Modify Date: 2026-09-06 18:20:26
2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid structure
|
Common Name | 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 1602985-03-4 | Molecular Weight | 302.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5BrFNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5BrFNO2S |
|---|---|
| Molecular Weight | 302.12 |
| InChIKey | FMRJFOBIJJGVPH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1csc(-c2c(F)cccc2Br)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid? |
| A: Molecular weight of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid is 302.12. |
| Q: What is the SMILES notation of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid? |
| A: SMILES notation of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid is O=C(O)c1csc(-c2c(F)cccc2Br)n1. |
| Q: What is the CAS number of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid? |
| A: CAS number of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid is 1602985-03-4. |
| Q: What is the Chinese name of 1602985-03-4? |
| A: Chinese name of 1602985-03-4 is 1602985-03-4. |
| Q: What is the InChIKey of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid? |
| A: InChIKey of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid is FMRJFOBIJJGVPH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid? |
| A: Molecular formula of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid is C10H5BrFNO2S. |
| Q: What is the English name of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid? |
| A: The English name of 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid is 2-(2-Bromo-6-fluorophenyl)thiazole-4-carboxylic Acid. |