5-hydroxydopa
Modify Date: 2025-10-16 15:55:19
5-hydroxydopa structure
|
Common Name | 5-hydroxydopa | ||
|---|---|---|---|---|
| CAS Number | 16032-83-0 | Molecular Weight | 213.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3-(3,4,5-trihydroxyphenyl)propanoic acid |
|---|
| Molecular Formula | C9H11NO5 |
|---|---|
| Molecular Weight | 213.18700 |
| Exact Mass | 213.06400 |
| PSA | 124.01000 |
| LogP | 0.45810 |
| Vapour Pressure | 8.5E-12mmHg at 25°C |
| InChIKey | KQZQZOQFUQXPLW-YFKPBYRVSA-N |
| SMILES | NC(Cc1cc(O)c(O)c(O)c1)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |