Xanthosine, dioxime(9CI) structure
|
Common Name | Xanthosine, dioxime(9CI) | ||
|---|---|---|---|---|
| CAS Number | 16033-28-6 | Molecular Weight | 314.25500 | |
| Density | 2.32g/cm3 | Boiling Point | 853.1ºC at 760mmHg | |
| Molecular Formula | C10H14N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 469.8ºC | |
| Name | 9H-Purine, 2,6-bis(hydroxyamino)-9-.β.-D-ribofuranosyl |
|---|---|
| Synonym | More Synonyms |
| Density | 2.32g/cm3 |
|---|---|
| Boiling Point | 853.1ºC at 760mmHg |
| Molecular Formula | C10H14N6O6 |
| Molecular Weight | 314.25500 |
| Flash Point | 469.8ºC |
| Exact Mass | 314.09700 |
| PSA | 184.50000 |
| Vapour Pressure | 5.59E-31mmHg at 25°C |
| Index of Refraction | 1.96 |
| InChIKey | SHMRWYRHOVJFOZ-UHFFFAOYSA-N |
| SMILES | OCC1OC(n2cnc3c(NO)nc(NO)nc32)C(O)C1O |
|
~31%
Xanthosine, dio... CAS#:16033-28-6 |
| Literature: Golubeva; Shipitsyn Russian Journal of Bioorganic Chemistry, 2007 , vol. 33, # 6 p. 562 - 568 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (+/-)-1-(2,6,6-trimethyl-4-hydroxycyclohexenyl)-1,3-butanedione |
| 1,3-Butanedione,1-(4-hydroxy-2,6,6-trimethyl-1-cyclohexen-1-yl) |
| 1-(2,6,6-Trimethyl-4-hydroxy-1-cyclohexen-1-yl)-1,3-butanedione |
| 2,6-bis(hydroxylamino)purine riboside |