Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate
Modify Date: 2026-09-26 21:55:55
![Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate Structure](https://www.chemsrc.com/extcaspic/404/1603317-88-9.png)
Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate structure
|
Common Name | Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1603317-88-9 | Molecular Weight | 222.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11FO3 |
|---|---|
| Molecular Weight | 222.21 |
| InChIKey | VOECTBPQYJDXSB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1OC12CCc1cc(F)ccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1603317-88-9? |
| A: Chinese name of 1603317-88-9 is 1603317-88-9. |
| Q: What is the InChIKey of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate? |
| A: InChIKey of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate is VOECTBPQYJDXSB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate? |
| A: SMILES notation of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate is COC(=O)C1OC12CCc1cc(F)ccc12. |
| Q: What is the molecular weight of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate? |
| A: Molecular weight of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate is 222.21. |
| Q: What is the CAS number of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate? |
| A: CAS number of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate is 1603317-88-9. |
| Q: What is the English name of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate? |
| A: The English name of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate is Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate. |
| Q: What is the molecular formula of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate? |
| A: Molecular formula of Methyl 5-fluoro-2,3-dihydrospiro[indene-1,2'-oxirane]-3'-carboxylate is C12H11FO3. |