1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane
Modify Date: 2025-09-09 18:22:24
![1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane Structure](https://www.chemsrc.com/extcaspic/169/1603318-14-4.png)
1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane structure
|
Common Name | 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane | ||
|---|---|---|---|---|
| CAS Number | 1603318-14-4 | Molecular Weight | 303.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18BrF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18BrF3O |
|---|---|
| Molecular Weight | 303.16 |
| InChIKey | LFNMISPNVDTPMM-UHFFFAOYSA-N |
| SMILES | CC(OC1CCCCCCC1Br)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane? |
| A: CAS number of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane is 1603318-14-4. |
| Q: What is the InChIKey of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane? |
| A: InChIKey of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane is LFNMISPNVDTPMM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane? |
| A: SMILES notation of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane is CC(OC1CCCCCCC1Br)C(F)(F)F. |
| Q: What is the Chinese name of 1603318-14-4? |
| A: Chinese name of 1603318-14-4 is 1603318-14-4. |
| Q: What is the molecular formula of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane? |
| A: Molecular formula of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane is C11H18BrF3O. |
| Q: What is the molecular weight of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane? |
| A: Molecular weight of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane is 303.16. |
| Q: What is the English name of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane? |
| A: The English name of 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane is 1-Bromo-2-[(1,1,1-trifluoropropan-2-yl)oxy]cyclooctane. |