3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide
Modify Date: 2026-07-12 20:29:27
3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide structure
|
Common Name | 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 1603394-80-4 | Molecular Weight | 358.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10F3IO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H10F3IO3S |
|---|---|
| Molecular Weight | 358.12 |
| InChIKey | OBJVXWSPKCRVOQ-UHFFFAOYSA-N |
| SMILES | CC(OC1CS(=O)(=O)CC1I)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide? |
| A: Molecular formula of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide is C7H10F3IO3S. |
| Q: What is the CAS number of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide? |
| A: CAS number of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide is 1603394-80-4. |
| Q: What is the Chinese name of 1603394-80-4? |
| A: Chinese name of 1603394-80-4 is 1603394-80-4. |
| Q: What is the SMILES notation of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide? |
| A: SMILES notation of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide is CC(OC1CS(=O)(=O)CC1I)C(F)(F)F. |
| Q: What is the English name of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide? |
| A: The English name of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide is 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide. |
| Q: What is the InChIKey of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide? |
| A: InChIKey of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide is OBJVXWSPKCRVOQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide? |
| A: Molecular weight of 3-Iodo-4-((1,1,1-trifluoropropan-2-yl)oxy)tetrahydrothiophene 1,1-dioxide is 358.12. |