(Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine
Modify Date: 2026-07-15 20:26:55
![(Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine Structure](https://www.chemsrc.com/extcaspic/454/1603476-47-6.png)
(Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine structure
|
Common Name | (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine | ||
|---|---|---|---|---|
| CAS Number | 1603476-47-6 | Molecular Weight | 238.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13F3N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13F3N2S |
|---|---|
| Molecular Weight | 238.28 |
| InChIKey | CVMQBFRHWDVVCN-UHFFFAOYSA-N |
| SMILES | CCC(C)NCc1csc(C(F)(F)F)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine? |
| A: CAS number of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine is 1603476-47-6. |
| Q: What is the molecular weight of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine? |
| A: Molecular weight of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine is 238.28. |
| Q: What is the English name of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine? |
| A: The English name of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine is (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine. |
| Q: What is the molecular formula of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine? |
| A: Molecular formula of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine is C9H13F3N2S. |
| Q: What is the Chinese name of 1603476-47-6? |
| A: Chinese name of 1603476-47-6 is 1603476-47-6. |
| Q: What is the SMILES notation of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine? |
| A: SMILES notation of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine is CCC(C)NCc1csc(C(F)(F)F)n1. |
| Q: What is the InChIKey of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine? |
| A: InChIKey of (Butan-2-yl)({[2-(trifluoromethyl)-1,3-thiazol-4-yl]methyl})amine is CVMQBFRHWDVVCN-UHFFFAOYSA-N. |