2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride
Modify Date: 2025-09-09 18:59:04
2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride structure
|
Common Name | 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1603723-80-3 | Molecular Weight | 270.80 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H23ClN2O |
|---|---|
| Molecular Weight | 270.80 |
| InChIKey | PCBNVEWJANWGAF-UHFFFAOYSA-N |
| SMILES | CCC(C)C(N)C(=O)N(C)Cc1ccccc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride? |
| A: InChIKey of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride is PCBNVEWJANWGAF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride? |
| A: Molecular weight of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride is 270.80. |
| Q: What is the SMILES notation of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride? |
| A: SMILES notation of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride is CCC(C)C(N)C(=O)N(C)Cc1ccccc1.Cl. |
| Q: What is the English name of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride? |
| A: The English name of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride is 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride. |
| Q: What is the CAS number of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride? |
| A: CAS number of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride is 1603723-80-3. |
| Q: What is the Chinese name of 1603723-80-3? |
| A: Chinese name of 1603723-80-3 is 1603723-80-3. |
| Q: What is the molecular formula of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride? |
| A: Molecular formula of 2-amino-N-benzyl-N,3-dimethylpentanamide hydrochloride is C14H23ClN2O. |