Bolasterone structure
|
Common Name | Bolasterone | ||
|---|---|---|---|---|
| CAS Number | 1605-89-6 | Molecular Weight | 316.478 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 441.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.0±21.3 °C | |
| Name | Bolasterone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.0±45.0 °C at 760 mmHg |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.478 |
| Flash Point | 188.0±21.3 °C |
| Exact Mass | 316.240234 |
| PSA | 37.30000 |
| LogP | 4.51 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | IVFYLRMMHVYGJH-VLOLGRDOSA-N |
| SMILES | CC1CC2=CC(=O)CCC2(C)C2CCC3(C)C(CCC3(C)O)C12 |
|
~%
Bolasterone CAS#:1605-89-6 |
| Literature: Schering Aktiengesellschaft Patent: US4100027 A1, 1978 ; |
|
~%
Bolasterone CAS#:1605-89-6 |
| Literature: Campbell; Babcock Journal of the American Chemical Society, 1959 , vol. 81, p. 4069,4071 |
|
~%
Bolasterone CAS#:1605-89-6 |
| Literature: Campbell; Babcock Journal of the American Chemical Society, 1959 , vol. 81, p. 4069,4071 |
| Myagen |
| 7α,17-Dimethyltestosterone |
| Androst-4-en-3-one, 17β-hydroxy-7α,17-dimethyl- |
| (7α,17β)-17-Hydroxy-7,17-dimethylandrost-4-en-3-one |
| bolasterone |
| Androst-4-en-3-one, 17-hydroxy-7,17-dimethyl-, (17β)- |
| 7a,17-Dimethyltestosterone |
| Androst-4-en-3-one, 17-hydroxy-7,17-dimethyl-, (7α,17β)- |
| (7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-7,10,13,17-tetramethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| 17b-Hydroxy-7a,17-dimethylandrost-4-en-3-one |
| (7a,17b)-17-Hydroxy-7,17-dimethylandrost-4-en-3-one |
| (17β)-17-Hydroxy-7,17-dimethylandrost-4-en-3-one |
| 7a,17a-Dimethyltestosterone |
| 7α,17α-Dimethyltestosterone |
| 17β-Hydroxy-7α,17-dimethylandrost-4-en-3-one |