N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide
Modify Date: 2025-09-10 11:15:18
![N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide Structure](https://www.chemsrc.com/extcaspic/148/1605054-41-8.png)
N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide structure
|
Common Name | N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1605054-41-8 | Molecular Weight | 308.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24N2O2S |
|---|---|
| Molecular Weight | 308.4 |
| InChIKey | YCIFBUCTHNPSBP-UHFFFAOYSA-N |
| SMILES | NCC(NC(=O)c1cc2c(s1)CCOC2)C1CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide? |
| A: CAS number of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide is 1605054-41-8. |
| Q: What is the Chinese name of 1605054-41-8? |
| A: Chinese name of 1605054-41-8 is 1605054-41-8. |
| Q: What is the molecular weight of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide? |
| A: Molecular weight of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide is 308.4. |
| Q: What is the English name of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide? |
| A: The English name of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide is N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide. |
| Q: What is the molecular formula of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide? |
| A: Molecular formula of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide is C16H24N2O2S. |
| Q: What is the SMILES notation of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide? |
| A: SMILES notation of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide is NCC(NC(=O)c1cc2c(s1)CCOC2)C1CCCCC1. |
| Q: What is the InChIKey of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide? |
| A: InChIKey of N-(2-amino-1-cyclohexylethyl)-4H,6H,7H-thieno[3,2-c]pyran-2-carboxamide is YCIFBUCTHNPSBP-UHFFFAOYSA-N. |