α-[2-(Diethylamino)ethyl]-α-isopropyl-1-naphthaleneacetamide structure
|
Common Name | α-[2-(Diethylamino)ethyl]-α-isopropyl-1-naphthaleneacetamide | ||
|---|---|---|---|---|
| CAS Number | 1606-09-3 | Molecular Weight | 326.47600 | |
| Density | 1.039g/cm3 | Boiling Point | 504.4ºC at 760mmHg | |
| Molecular Formula | C21H30N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.9ºC | |
| Name | 2-[2-(diethylamino)ethyl]-3-methyl-2-naphthalen-1-ylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 504.4ºC at 760mmHg |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.47600 |
| Flash Point | 258.9ºC |
| Exact Mass | 326.23600 |
| PSA | 47.32000 |
| LogP | 5.10050 |
| Vapour Pressure | 2.66E-10mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | RPVBPDPLQFCQRB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(C(N)=O)(c1cccc2ccccc12)C(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[2-(diethylamino)ethyl]-3-methyl-2-(1-naphthyl)butanamide |
| Butyramide,4-(diethylamino)-2-isopropyl-2-(1-naphthyl) |
| Butyramide,2-(2-(diethylamino)ethyl)-3-methyl-2-(1-naphthyl) |