2-[(4-Methylphenyl)sulfonyl]-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylic acid tert-butyl ester structure
|
Common Name | 2-[(4-Methylphenyl)sulfonyl]-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 160732-46-7 | Molecular Weight | 347.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 3-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21NO4S |
|---|---|
| Molecular Weight | 347.42900 |
| Exact Mass | 347.11900 |
| PSA | 72.06000 |
| LogP | 4.22900 |
| InChIKey | DSEJXEOLOHIGIZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C2=CC3C=CC2N3C(=O)OC(C)(C)C)cc1 |
|
~63%
2-[(4-Methylphe... CAS#:160732-46-7 |
| Literature: Research Triangle Institute Patent: US6538010 B1, 2003 ; |
|
~88%
2-[(4-Methylphe... CAS#:160732-46-7 |
| Literature: Gregersen, Anette; Pedersen, Christian Marcus; Jensen, Henrik Helligso; Bols, Mikael Organic and Biomolecular Chemistry, 2005 , vol. 3, # 8 p. 1514 - 1519 |
|
~%
2-[(4-Methylphe... CAS#:160732-46-7 |
| Literature: Dolci, Lilian; Dolle, Frederic; Valette, Heric; Vaufrey, Francoise; Fuseau, Chantal; Bottlaender, Michel; Crouzel, Christian Bioorganic and Medicinal Chemistry, 1999 , vol. 7, # 3 p. 467 - 479 |
|
~%
2-[(4-Methylphe... CAS#:160732-46-7 |
| Literature: Dolci, Lilian; Dolle, Frederic; Valette, Heric; Vaufrey, Francoise; Fuseau, Chantal; Bottlaender, Michel; Crouzel, Christian Bioorganic and Medicinal Chemistry, 1999 , vol. 7, # 3 p. 467 - 479 |
| endo-2-(p-tolyl-sulfone)-7-tert-butoxycarbonyl-7-azabicyclo<2.2.1>hepta-2,5-diene |
| 2-p-toluenesulfonyl-7-(tert-butoxycarbonyl)-7-azabicyclo[2.2.1]hepta-2,5-diene |
| (+/-)-7-tert-butoxycarbonyl-2-(4-toluenesulfonyl)-7-azabicyclo[2.2.1]hepta-2,5-diene |
| 7-tert-Butoxycarbonyl-2-p-tolylsulfonyl-7-azabicyclo[2.2.1]-hepta-2,5-diene |
| 2-[(4-Methylphenyl)sulfonyl]-7-azabicyclo[2.2.1]hepta-2,5-diene-7-carboxylic acid tert-butyl ester |