1-benzyl-5-methoxyindoline-2,3-dione
1-benzyl-5-methoxyindoline-2,3-dione structure
|
Common Name | 1-benzyl-5-methoxyindoline-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 16077-10-4 | Molecular Weight | 267.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-benzyl-5-methoxyindole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13NO3 |
|---|---|
| Molecular Weight | 267.27900 |
| Exact Mass | 267.09000 |
| PSA | 46.61000 |
| LogP | 2.48970 |
| InChIKey | ZBLQKVFGHHQVMS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2Cc1ccccc1 |
| Storage condition | 2-8°C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
1-benzyl-5-meth... CAS#:16077-10-4 |
| Literature: NISSAN CHEMICAL INDUSTRIES, LTD. Patent: WO2005/90357 A1, 2005 ; Location in patent: Page/Page column 406-407 ; WO 2005/090357 A1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole-2,3-dione,5-methoxy-1-(phenylmethyl) |
| 1-benzyl-5-methoxyindoline-2,3-dione |
| 5-methoxy-N-benzylisatin |
| 1-benzyl-5-methoxy-indole-2,3-dione |
| N-benzyl-5-methoxyisatin |
| 5-methoxyisatin |
| 1-benzyl-5-methoxy-1H-indol-2,3-dione |
| 1-benzyl-5-methoxyindolin-2,3-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-benzyl-5-methoxyindole-2,3-dione? |
| A: LogP of 1-benzyl-5-methoxyindole-2,3-dione is 2.48970. |
| Q: What is the molecular weight of 1-benzyl-5-methoxyindole-2,3-dione? |
| A: Molecular weight of 1-benzyl-5-methoxyindole-2,3-dione is 267.27900. |
| Q: What is the InChIKey of 1-benzyl-5-methoxyindole-2,3-dione? |
| A: InChIKey of 1-benzyl-5-methoxyindole-2,3-dione is ZBLQKVFGHHQVMS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-benzyl-5-methoxyindole-2,3-dione? |
| A: Molecular formula of 1-benzyl-5-methoxyindole-2,3-dione is C16H13NO3. |
| Q: What are the storage conditions for 1-benzyl-5-methoxyindole-2,3-dione? |
| A: Storage conditions for 1-benzyl-5-methoxyindole-2,3-dione: 2-8°C. |
| Q: What is the English name of 1-benzyl-5-methoxyindole-2,3-dione? |
| A: The English name of 1-benzyl-5-methoxyindole-2,3-dione is 1-benzyl-5-methoxyindole-2,3-dione. |
| Q: What is the CAS number of 1-benzyl-5-methoxyindole-2,3-dione? |
| A: CAS number of 1-benzyl-5-methoxyindole-2,3-dione is 16077-10-4. |
| Q: What English synonyms does 1-benzyl-5-methoxyindole-2,3-dione have? |
| A: English synonyms of 1-benzyl-5-methoxyindole-2,3-dione: 1H-Indole-2,3-dione,5-methoxy-1-(phenylmethyl), 1-benzyl-5-methoxyindoline-2,3-dione, 5-methoxy-N-benzylisatin, 1-benzyl-5-methoxy-indole-2,3-dione, N-benzyl-5-methoxyisatin, 5-methoxyisatin, 1-benzyl-5-methoxy-1H-indol-2,3-dione, 1-benzyl-5-methoxyindolin-2,3-dione. |
| Q: What is the SMILES notation of 1-benzyl-5-methoxyindole-2,3-dione? |
| A: SMILES notation of 1-benzyl-5-methoxyindole-2,3-dione is COc1ccc2c(c1)C(=O)C(=O)N2Cc1ccccc1. |
| Q: What is the polar surface area (PSA) of 1-benzyl-5-methoxyindole-2,3-dione? |
| A: Polar surface area (PSA) of 1-benzyl-5-methoxyindole-2,3-dione is 46.61000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |