2,3,5,7,9,10-Hexaaza-6-phosphaundecanedioicacid, 6-[[[2-(ethoxycarbonyl)hydrazino]carbonyl]amino]-4,8-dioxo-, diethylester, 6-oxide (9CI) structure
|
Common Name | 2,3,5,7,9,10-Hexaaza-6-phosphaundecanedioicacid, 6-[[[2-(ethoxycarbonyl)hydrazino]carbonyl]amino]-4,8-dioxo-, diethylester, 6-oxide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 16077-70-6 | Molecular Weight | 485.34700 | |
| Density | 1.462g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H24N9O10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[bis[(ethoxycarbonylamino)carbamoylamino]phosphorylcarbamoylamino]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.462g/cm3 |
|---|---|
| Molecular Formula | C12H24N9O10P |
| Molecular Weight | 485.34700 |
| Exact Mass | 485.13800 |
| PSA | 265.26000 |
| LogP | 2.49350 |
| Index of Refraction | 1.528 |
| InChIKey | AIWVESGHCFMUKG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NNC(=O)NP(=O)(NC(=O)NNC(=O)OCC)NC(=O)NNC(=O)OCC |
|
~%
2,3,5,7,9,10-He... CAS#:16077-70-6 |
| Literature: Cates; Nelson Journal of pharmaceutical sciences, 1968 , vol. 57, # 1 p. 189 - 190 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Triethyl-3,3',3''-<phosphinylidyn-tris(iminocarbonyl)>-tricarbazat |
| diethyl 6-({[2-(ethoxycarbonyl)hydrazinyl]carbonyl}amino)-4,8-dioxo-2,3,5,7,9,10-hexaaza-6-phosphaundecane-1,11-dioate 6-oxide |