N,N'-Bis(4-oxo-4-phenylbutylidene)-1,2-ethanediamine structure
|
Common Name | N,N'-Bis(4-oxo-4-phenylbutylidene)-1,2-ethanediamine | ||
|---|---|---|---|---|
| CAS Number | 16087-30-2 | Molecular Weight | 348.43800 | |
| Density | 1.04g/cm3 | Boiling Point | 521ºC at 760 mmHg | |
| Molecular Formula | C22H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.4ºC | |
| Name | 3-[2-[(4-oxo-4-phenylbutan-2-ylidene)amino]ethylimino]-1-phenylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 521ºC at 760 mmHg |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.43800 |
| Flash Point | 213.4ºC |
| Exact Mass | 348.18400 |
| PSA | 58.86000 |
| LogP | 4.45420 |
| Vapour Pressure | 5.93E-11mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | CODOLTFDVSRVJU-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)c1ccccc1)=NCCN=C(C)CC(=O)c1ccccc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Butyrophenone,3,3''-(ethylenedinitrilo)di |
| (3E,3'E)-3,3'-(ethane-1,2-diyldinitrilo)bis(1-phenylbutan-1-one) |
| 1,1'-diphenyl-3,3'-ethylenedinitrilobis(butan-1-one) |
| N,N'-ethylenebis(3-imino-1-phenyl-1-butanone) |
| N,N'-ethylene bis(1-phenylbutane-1,3-dioneimine) |
| N,N'-Ethylenebis(3-amino-1-phenyl-but-2-en-1-one) |
| ethylenediimino-bis-benzoylacetone |
| N,N'-Bis-<1-methyl-3-oxo-3-phenyl-propyliden>-aethylendiamin |
| 1-Butanone,3,3'-(1,2-ethanediyldinitrilo)bis[1-phenyl |
| bis-(benzoyl-acetone)-ethylene-diimine |
| 3,3''-<Aethylendinitrilo>-dibutyrophenon |