4-[([1,1'-Biphenyl]-4-ylcarbonyl)amino]-5-methyl-2-furancarboxylic acid
Modify Date: 2026-08-19 20:22:22
![4-[([1,1'-Biphenyl]-4-ylcarbonyl)amino]-5-methyl-2-furancarboxylic acid Structure](https://www.chemsrc.com/extcaspic/402/1609015-83-9.png)
4-[([1,1'-Biphenyl]-4-ylcarbonyl)amino]-5-methyl-2-furancarboxylic acid structure
|
Common Name | 4-[([1,1'-Biphenyl]-4-ylcarbonyl)amino]-5-methyl-2-furancarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1609015-83-9 | Molecular Weight | 321.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[([1,1'-Biphenyl]-4-ylcarbonyl)amino]-5-methyl-2-furancarboxylic acid |
|---|
| Molecular Formula | C19H15NO4 |
|---|---|
| Molecular Weight | 321.3 |
| InChIKey | AUCSIUCRKVYKJM-UHFFFAOYSA-N |
| SMILES | Cc1oc(C(=O)O)cc1NC(=O)c1ccc(-c2ccccc2)cc1 |
|
Name: Displacement of [3H]PGE2 from human prostanoid EP4 receptor expressed in cell membran...
Source: ChEMBL
Target: Prostaglandin E2 receptor EP4 subtype
External Id: CHEMBL3266970
|
Total 1, Current Page 1 of 1
1