3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one
Modify Date: 2026-09-28 08:24:44
3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one structure
|
Common Name | 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 1609073-07-5 | Molecular Weight | 268.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13ClN2O3 |
|---|---|
| Molecular Weight | 268.69 |
| InChIKey | NCXUWHRBXNTOQU-UHFFFAOYSA-N |
| SMILES | COc1cc2ncn(CCCl)c(=O)c2cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one? |
| A: CAS number of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one is 1609073-07-5. |
| Q: What is the Chinese name of 1609073-07-5? |
| A: Chinese name of 1609073-07-5 is 1609073-07-5. |
| Q: What is the English name of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one? |
| A: The English name of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one is 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one. |
| Q: What is the molecular formula of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one? |
| A: Molecular formula of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one is C12H13ClN2O3. |
| Q: What is the SMILES notation of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one? |
| A: SMILES notation of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one is COc1cc2ncn(CCCl)c(=O)c2cc1OC. |
| Q: What is the InChIKey of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one? |
| A: InChIKey of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one is NCXUWHRBXNTOQU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one? |
| A: Molecular weight of 3-(2-Chloroethyl)-6,7-dimethoxyquinazolin-4-one is 268.69. |