6-phenylmethoxy-8-(trifluoromethyl)-7H-purin-2-amine structure
|
Common Name | 6-phenylmethoxy-8-(trifluoromethyl)-7H-purin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 160948-29-8 | Molecular Weight | 309.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10F3N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-phenylmethoxy-8-(trifluoromethyl)-7H-purin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10F3N5O |
|---|---|
| Molecular Weight | 309.24700 |
| Exact Mass | 309.08400 |
| PSA | 90.44000 |
| LogP | 2.46300 |
| InChIKey | VZFRKMCCNQVAJK-UHFFFAOYSA-N |
| SMILES | Nc1nc(OCc2ccccc2)c2[nH]c(C(F)(F)F)nc2n1 |
|
~%
6-phenylmethoxy... CAS#:160948-29-8 |
| Literature: Chae; Swenn; Kanugula; Dolan; Pegg; Moschel Journal of Medicinal Chemistry, 1995 , vol. 38, # 2 p. 359 - 365 |
|
~%
6-phenylmethoxy... CAS#:160948-29-8 |
| Literature: Chae; Swenn; Kanugula; Dolan; Pegg; Moschel Journal of Medicinal Chemistry, 1995 , vol. 38, # 2 p. 359 - 365 |
| O6-benzyl-8-(trifluoromethyl)guanine |
| 2-amino-6-benzyloxy-8-(trifluoromethyl)purine |
| 1H-Purin-2-amine,6-(phenylmethoxy)-8-(trifluoromethyl) |