(S)-6-Chloro-2-(3-methoxypropyl)-3,4-dihydro-2H-thieno[3,2-e][1,2]thiazin-4-ol 1,1-dioxide structure
|
Common Name | (S)-6-Chloro-2-(3-methoxypropyl)-3,4-dihydro-2H-thieno[3,2-e][1,2]thiazin-4-ol 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 160982-13-8 | Molecular Weight | 311.80500 | |
| Density | 1.49 | Boiling Point | 466.142ºC at 760 mmHg | |
| Molecular Formula | C10H14ClNO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4S)-6-chloro-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49 |
|---|---|
| Boiling Point | 466.142ºC at 760 mmHg |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.80500 |
| Exact Mass | 311.00500 |
| PSA | 103.46000 |
| LogP | 2.49440 |
| InChIKey | FMNGDEKOOMHKNT-MRVPVSSYSA-N |
| SMILES | COCCCN1CC(O)c2cc(Cl)sc2S1(=O)=O |
| HS Code | 2934999090 |
|---|
|
~%
(S)-6-Chloro-2-... CAS#:160982-13-8 |
| Literature: Organic Process Research and Development, , vol. 3, # 2 p. 114 - 120 |
|
~%
(S)-6-Chloro-2-... CAS#:160982-13-8 |
| Literature: Organic Process Research and Development, , vol. 3, # 2 p. 114 - 120 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (S)-3,4-dihydro-6-chloro-4-hydroxy-2-(3-methoxypropyl)-2H thieno[3,2-e]-1,2-thiazine-1,1-dioxide |
| (S)-3,4-dihydro-6-chloro-4-hydroxy-2-(3-methoxypropyl)-4H-thieno[3,2-e]-1,2-thiazine 1,1-dioxide |
| (S)-6-Chloro-4-hydroxy-2-(3-methoxypropyl)-3,4-dihydro-2H-thieno[3,2-e][1,2]thiazine 1,1-dioxide |
| (S)-6-Chloro-2-(3-methoxy-propyl)-1 |
| (S)-6-chloro-3,4-dihydro-2-(3-methoxypropyl)-2H-thieno[3,2-e]-1,2-thiazin-4-ol 1,1-dioxide |
| (S)-6-Chloro-2-(3-methoxypropyl)-3,4-dihydro-2H-thieno[3,2-e][1,2]thiazin-4-ol 1,1-dioxide |
| Brinzolamide Impurity 6 |