STS-E412 structure
|
Common Name | STS-E412 | ||
|---|---|---|---|---|
| CAS Number | 1609980-39-3 | Molecular Weight | 318.758 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of STS-E412STS-E412 is a selective activator of tissue-protective EPO receptor (including EPOR and CD131). STS-E412 can be used for research of neurodegenerative diseases and organ protection[1]. |
| Name | STS-E412 |
|---|---|
| Synonym | More Synonyms |
| Description | STS-E412 is a selective activator of tissue-protective EPO receptor (including EPOR and CD131). STS-E412 can be used for research of neurodegenerative diseases and organ protection[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.758 |
| Exact Mass | 318.088348 |
| LogP | 3.55 |
| Index of Refraction | 1.638 |
| InChIKey | XQFMOBKQELKMKF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n2nc(OCCOc3ccc(Cl)cc3)nc2n1 |
| S174607 |
| [1,2,4]Triazolo[1,5-a]pyrimidine, 2-[2-(4-chlorophenoxy)ethoxy]-5,7-dimethyl- |
| MFCD30530429 |
| 2-[2-(4-Chlorophenoxy)ethoxy]-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine |