9-methoxy-1,5-dimethyl-6H-pyrido[4,3-b]carbazole structure
|
Common Name | 9-methoxy-1,5-dimethyl-6H-pyrido[4,3-b]carbazole | ||
|---|---|---|---|---|
| CAS Number | 16101-08-9 | Molecular Weight | 276.33200 | |
| Density | 1.256g/cm3 | Boiling Point | 523.4ºC at 760mmHg | |
| Molecular Formula | C18H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.1ºC | |
| Name | 9-methoxy-1,5-dimethyl-6H-pyrido[4,3-b]carbazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 523.4ºC at 760mmHg |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.33200 |
| Flash Point | 168.1ºC |
| Exact Mass | 276.12600 |
| PSA | 37.91000 |
| LogP | 4.49470 |
| Vapour Pressure | 1.59E-10mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | RVJXLUHXHYTGNH-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3c(C)c4cc[nH]c(C)c4cc3c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
9-methoxy-1,5-d... CAS#:16101-08-9 |
| Literature: Jatztold-Howorko; Bisagni; Chermann European Journal of Medicinal Chemistry, 1984 , vol. 19, # 6 p. 541 - 544 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 240-265-1 |
| 9-Methoxy-1,5-dimethyl-6H-pyrido(4,3-b)carbazole |
| 9-Methoxyolivacin |
| 9-methoxyellipticine |
| 10-Methoxyolivacine |
| methoxy-9 olivacine |
| 9-Methoxyolivacine |