4-(Benzyloxy)indoline-2,3-dione
Modify Date: 2026-09-27 21:19:01
4-(Benzyloxy)indoline-2,3-dione structure
|
Common Name | 4-(Benzyloxy)indoline-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1610457-25-4 | Molecular Weight | 253.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Benzyloxy)indoline-2,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11NO3 |
|---|---|
| Molecular Weight | 253.25 |
| InChIKey | DAOMOFOTJGYQOB-UHFFFAOYSA-N |
| SMILES | O=C1Nc2cccc(OCc3ccccc3)c2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(Benzyloxy)indoline-2,3-dione? |
| A: CAS number of 4-(Benzyloxy)indoline-2,3-dione is 1610457-25-4. |
| Q: What is the molecular formula of 4-(Benzyloxy)indoline-2,3-dione? |
| A: Molecular formula of 4-(Benzyloxy)indoline-2,3-dione is C15H11NO3. |
| Q: What is the Chinese name of 1610457-25-4? |
| A: Chinese name of 1610457-25-4 is 1610457-25-4. |
| Q: What is the English name of 4-(Benzyloxy)indoline-2,3-dione? |
| A: The English name of 4-(Benzyloxy)indoline-2,3-dione is 4-(Benzyloxy)indoline-2,3-dione. |
| Q: What is the InChIKey of 4-(Benzyloxy)indoline-2,3-dione? |
| A: InChIKey of 4-(Benzyloxy)indoline-2,3-dione is DAOMOFOTJGYQOB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(Benzyloxy)indoline-2,3-dione? |
| A: Molecular weight of 4-(Benzyloxy)indoline-2,3-dione is 253.25. |
| Q: What is the SMILES notation of 4-(Benzyloxy)indoline-2,3-dione? |
| A: SMILES notation of 4-(Benzyloxy)indoline-2,3-dione is O=C1Nc2cccc(OCc3ccccc3)c2C1=O. |