5-(Benzyloxy)-2,4-di-tert-butylaniline
Modify Date: 2026-08-23 23:12:13
5-(Benzyloxy)-2,4-di-tert-butylaniline structure
|
Common Name | 5-(Benzyloxy)-2,4-di-tert-butylaniline | ||
|---|---|---|---|---|
| CAS Number | 1610595-15-7 | Molecular Weight | 311.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Benzyloxy)-2,4-di-tert-butylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H29NO |
|---|---|
| Molecular Weight | 311.5 |
| InChIKey | IBKZZPXTIRRPAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(OCc2ccccc2)cc1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(Benzyloxy)-2,4-di-tert-butylaniline? |
| A: Molecular weight of 5-(Benzyloxy)-2,4-di-tert-butylaniline is 311.5. |
| Q: What is the molecular formula of 5-(Benzyloxy)-2,4-di-tert-butylaniline? |
| A: Molecular formula of 5-(Benzyloxy)-2,4-di-tert-butylaniline is C21H29NO. |
| Q: What is the English name of 5-(Benzyloxy)-2,4-di-tert-butylaniline? |
| A: The English name of 5-(Benzyloxy)-2,4-di-tert-butylaniline is 5-(Benzyloxy)-2,4-di-tert-butylaniline. |
| Q: What is the CAS number of 5-(Benzyloxy)-2,4-di-tert-butylaniline? |
| A: CAS number of 5-(Benzyloxy)-2,4-di-tert-butylaniline is 1610595-15-7. |
| Q: What is the InChIKey of 5-(Benzyloxy)-2,4-di-tert-butylaniline? |
| A: InChIKey of 5-(Benzyloxy)-2,4-di-tert-butylaniline is IBKZZPXTIRRPAA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-(Benzyloxy)-2,4-di-tert-butylaniline? |
| A: SMILES notation of 5-(Benzyloxy)-2,4-di-tert-butylaniline is CC(C)(C)c1cc(C(C)(C)C)c(OCc2ccccc2)cc1N. |
| Q: What is the Chinese name of 1610595-15-7? |
| A: Chinese name of 1610595-15-7 is 1610595-15-7. |