Ethanamine,N,N',N''-[phosphinidynetris(methylene)]tris[N-ethyl structure
|
Common Name | Ethanamine,N,N',N''-[phosphinidynetris(methylene)]tris[N-ethyl | ||
|---|---|---|---|---|
| CAS Number | 16111-57-2 | Molecular Weight | 289.44000 | |
| Density | N/A | Boiling Point | 336ºC at 760mmHg | |
| Molecular Formula | C15H36N3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157ºC | |
| Name | N-[bis(diethylaminomethyl)phosphanylmethyl]-N-ethylethanamine |
|---|
| Boiling Point | 336ºC at 760mmHg |
|---|---|
| Molecular Formula | C15H36N3P |
| Molecular Weight | 289.44000 |
| Flash Point | 157ºC |
| Exact Mass | 289.26500 |
| PSA | 23.31000 |
| LogP | 3.36620 |
| Vapour Pressure | 0.000115mmHg at 25°C |
| InChIKey | OLAVNUMCBMWBMW-UHFFFAOYSA-N |
| SMILES | CCN(CC)CP(CN(CC)CC)CN(CC)CC |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|